C20H17F3N4O4 — CID 126109455
ethyl 2-[3-[(Z)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]indol-1-yl]acetate (PubChem CID 126109455) has the molecular formula C20H17F3N4O4 and a molecular weight of 434.37 g/mol. Its IUPAC name is ethyl 2-[3-[(Z)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]indol-1-yl]acetate.
| Compound Name | ethyl 2-[3-[(Z)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 126109455 |
| Molecular Formula | C20H17F3N4O4 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | ethyl 2-[3-[(Z)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]indol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1cc(/C=N\Nc2ccc(C(F)(F)F)cc2[N+](=O)[O-])c2ccccc21 |
| InChI | InChI=1S/C20H17F3N4O4/c1-2-31-19(28)12-26-11-13(15-5-3-4-6-17(15)26)10-24-25-16-8-7-14(20(21,22)23)9-18(16)27(29)30/h3-11,25H,2,12H2,1H3/b24-10- |
| InChIKey | ARDXFKRPQGMKKX-VROXFSQNSA-N |
| XLogP | 4.58 |
| TPSA | 98.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|