C26H19N5O4 — CID 126218763
N-[(E)-[1-(naphthalen-2-ylmethyl)indol-3-yl]methylideneamino]-2,4-dinitroaniline (PubChem CID 126218763) has the molecular formula C26H19N5O4 and a molecular weight of 465.47 g/mol. Its IUPAC name is N-[(E)-[1-(naphthalen-2-ylmethyl)indol-3-yl]methylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[(E)-[1-(naphthalen-2-ylmethyl)indol-3-yl]methylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 126218763 |
| Molecular Formula | C26H19N5O4 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | N-[(E)-[1-(naphthalen-2-ylmethyl)indol-3-yl]methylideneamino]-2,4-dinitroaniline |
| SMILES | O=[N+]([O-])c1ccc(N/N=C/c2cn(Cc3ccc4ccccc4c3)c3ccccc23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H19N5O4/c32-30(33)22-11-12-24(26(14-22)31(34)35)28-27-15-21-17-29(25-8-4-3-7-23(21)25)16-18-9-10-19-5-1-2-6-20(19)13-18/h1-15,17,28H,16H2/b27-15+ |
| InChIKey | QZVUDMCSQBTRQK-JFLMPSFJSA-N |
| XLogP | 6.11 |
| TPSA | 115.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|