C22H17ClN2O3 — CID 126398177
methyl 5-[[3-[(3-chlorophenyl)iminomethyl]indol-1-yl]methyl]furan-2-carboxylate (PubChem CID 126398177) has the molecular formula C22H17ClN2O3 and a molecular weight of 392.84 g/mol. Its IUPAC name is methyl 5-[[3-[(3-chlorophenyl)iminomethyl]indol-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[3-[(3-chlorophenyl)iminomethyl]indol-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126398177 |
| Molecular Formula | C22H17ClN2O3 |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | methyl 5-[[3-[(3-chlorophenyl)iminomethyl]indol-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(Cn2cc(/C=N/c3cccc(Cl)c3)c3ccccc32)o1 |
| InChI | InChI=1S/C22H17ClN2O3/c1-27-22(26)21-10-9-18(28-21)14-25-13-15(19-7-2-3-8-20(19)25)12-24-17-6-4-5-16(23)11-17/h2-13H,14H2,1H3/b24-12+ |
| InChIKey | RORUXKLNNUKFDC-WYMPLXKRSA-N |
| XLogP | 5.47 |
| TPSA | 56.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|