C23H18ClN3O5 — CID 3902657
5-[[3-[[[2-(3-chlorophenoxy)acetyl]hydrazinylidene]methyl]indol-1-yl]methyl]furan-2-carboxylic acid (PubChem CID 3902657) has the molecular formula C23H18ClN3O5 and a molecular weight of 451.87 g/mol. Its IUPAC name is 5-[[3-[[[2-(3-chlorophenoxy)acetyl]hydrazinylidene]methyl]indol-1-yl]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[3-[[[2-(3-chlorophenoxy)acetyl]hydrazinylidene]methyl]indol-1-yl]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 3902657 |
| Molecular Formula | C23H18ClN3O5 |
| Molecular Weight | 451.87 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | 5-[[3-[[[2-(3-chlorophenoxy)acetyl]hydrazinylidene]methyl]indol-1-yl]methyl]furan-2-carboxylic acid |
| SMILES | O=C(COc1cccc(Cl)c1)NN=Cc1cn(Cc2ccc(C(=O)O)o2)c2ccccc12 |
| InChI | InChI=1S/C23H18ClN3O5/c24-16-4-3-5-17(10-16)31-14-22(28)26-25-11-15-12-27(20-7-2-1-6-19(15)20)13-18-8-9-21(32-18)23(29)30/h1-12H,13-14H2,(H,26,28)(H,29,30) |
| InChIKey | KOQNXDHUDUZBMB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.87 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|