C25H22ClN3O2 — CID 51393753
N-[(Z)-(1-benzylindol-3-yl)methylideneamino]-2-(4-chloro-2-methylphenoxy)acetamide (PubChem CID 51393753) has the molecular formula C25H22ClN3O2 and a molecular weight of 431.92 g/mol. Its IUPAC name is N-[(Z)-(1-benzylindol-3-yl)methylideneamino]-2-(4-chloro-2-methylphenoxy)acetamide.
| Compound Name | N-[(Z)-(1-benzylindol-3-yl)methylideneamino]-2-(4-chloro-2-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 51393753 |
| Molecular Formula | C25H22ClN3O2 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | N-[(Z)-(1-benzylindol-3-yl)methylideneamino]-2-(4-chloro-2-methylphenoxy)acetamide |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)N/N=C\c1cn(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C25H22ClN3O2/c1-18-13-21(26)11-12-24(18)31-17-25(30)28-27-14-20-16-29(15-19-7-3-2-4-8-19)23-10-6-5-9-22(20)23/h2-14,16H,15,17H2,1H3,(H,28,30)/b27-14- |
| InChIKey | UIBCEBSDWDSTNT-VYYCAZPPSA-N |
| XLogP | 5.18 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|