C9H8F3N3O2 — CID 173369416
N-[(E)-ethylideneamino]-2-nitro-4-(trifluoromethyl)aniline (PubChem CID 173369416) has the molecular formula C9H8F3N3O2 and a molecular weight of 247.18 g/mol. Its IUPAC name is N-[(E)-ethylideneamino]-2-nitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(E)-ethylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 173369416 |
| Molecular Formula | C9H8F3N3O2 |
| Molecular Weight | 247.18 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | N-[(E)-ethylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
| SMILES | C/C=N/Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H8F3N3O2/c1-2-13-14-7-4-3-6(9(10,11)12)5-8(7)15(16)17/h2-5,14H,1H3/b13-2+ |
| InChIKey | WNPJTPGJVSGABN-XNJYKOPJSA-N |
| XLogP | 3.03 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.18 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|