C18H17FN5O+ — CID 135775153
(E)-(diaminomethylideneamino)-[[3-(4-fluorobenzoyl)-2-methylindolizin-1-yl]methylidene]azanium (PubChem CID 135775153) has the molecular formula C18H17FN5O+ and a molecular weight of 338.37 g/mol. Its IUPAC name is (E)-(diaminomethylideneamino)-[[3-(4-fluorobenzoyl)-2-methylindolizin-1-yl]methylidene]azanium.
| Compound Name | (E)-(diaminomethylideneamino)-[[3-(4-fluorobenzoyl)-2-methylindolizin-1-yl]methylidene]azanium |
|---|---|
| PubChem CID | 135775153 |
| Molecular Formula | C18H17FN5O+ |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | (E)-(diaminomethylideneamino)-[[3-(4-fluorobenzoyl)-2-methylindolizin-1-yl]methylidene]azanium |
| SMILES | Cc1c(/C=[NH+]/N=C(N)N)c2ccccn2c1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H16FN5O/c1-11-14(10-22-23-18(20)21)15-4-2-3-9-24(15)16(11)17(25)12-5-7-13(19)8-6-12/h2-10H,1H3,(H4,20,21,23)/p+1/b22-10+ |
| InChIKey | LJDQGTKZVQYUOO-LSHDLFTRSA-O |
| XLogP | 0.31 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|