C25H19F2N3O3 — CID 3269286
N-[[3-(4-fluorobenzoyl)-2-methylindolizin-1-yl]methylideneamino]-2-(2-fluorophenoxy)acetamide (PubChem CID 3269286) has the molecular formula C25H19F2N3O3 and a molecular weight of 447.44 g/mol. Its IUPAC name is N-[[3-(4-fluorobenzoyl)-2-methylindolizin-1-yl]methylideneamino]-2-(2-fluorophenoxy)acetamide.
| Compound Name | N-[[3-(4-fluorobenzoyl)-2-methylindolizin-1-yl]methylideneamino]-2-(2-fluorophenoxy)acetamide |
|---|---|
| PubChem CID | 3269286 |
| Molecular Formula | C25H19F2N3O3 |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | N-[[3-(4-fluorobenzoyl)-2-methylindolizin-1-yl]methylideneamino]-2-(2-fluorophenoxy)acetamide |
| SMILES | Cc1c(C=NNC(=O)COc2ccccc2F)c2ccccn2c1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H19F2N3O3/c1-16-19(14-28-29-23(31)15-33-22-8-3-2-6-20(22)27)21-7-4-5-13-30(21)24(16)25(32)17-9-11-18(26)12-10-17/h2-14H,15H2,1H3,(H,29,31) |
| InChIKey | XHEDOJNKUOUXRE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|