C28H27FN4O4S — CID 2458333
3-(diethylsulfamoyl)-N-[[3-(4-fluorobenzoyl)-2-methylindolizin-1-yl]methylideneamino]benzamide (PubChem CID 2458333) has the molecular formula C28H27FN4O4S and a molecular weight of 534.61 g/mol. Its IUPAC name is 3-(diethylsulfamoyl)-N-[[3-(4-fluorobenzoyl)-2-methylindolizin-1-yl]methylideneamino]benzamide.
| Compound Name | 3-(diethylsulfamoyl)-N-[[3-(4-fluorobenzoyl)-2-methylindolizin-1-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 2458333 |
| Molecular Formula | C28H27FN4O4S |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | 3-(diethylsulfamoyl)-N-[[3-(4-fluorobenzoyl)-2-methylindolizin-1-yl]methylideneamino]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)NN=Cc2c(C)c(C(=O)c3ccc(F)cc3)n3ccccc23)c1 |
| InChI | InChI=1S/C28H27FN4O4S/c1-4-32(5-2)38(36,37)23-10-8-9-21(17-23)28(35)31-30-18-24-19(3)26(33-16-7-6-11-25(24)33)27(34)20-12-14-22(29)15-13-20/h6-18H,4-5H2,1-3H3,(H,31,35) |
| InChIKey | QTDALEDGTDOJSP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|