C22H24ClN5O3S — CID 2094492
N-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-3-(diethylsulfamoyl)benzamide (PubChem CID 2094492) has the molecular formula C22H24ClN5O3S and a molecular weight of 473.99 g/mol. Its IUPAC name is N-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-3-(diethylsulfamoyl)benzamide.
| Compound Name | N-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-3-(diethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 2094492 |
| Molecular Formula | C22H24ClN5O3S |
| Molecular Weight | 473.99 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | N-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-3-(diethylsulfamoyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)NN=Cc2c(C)nn(-c3ccccc3)c2Cl)c1 |
| InChI | InChI=1S/C22H24ClN5O3S/c1-4-27(5-2)32(30,31)19-13-9-10-17(14-19)22(29)25-24-15-20-16(3)26-28(21(20)23)18-11-7-6-8-12-18/h6-15H,4-5H2,1-3H3,(H,25,29) |
| InChIKey | RCPKWBHZMPPWCI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.99 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|