C20H17ClFN5O2 — CID 5023705
N-[2-[2-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]hydrazinyl]-2-oxoethyl]-4-fluorobenzamide (PubChem CID 5023705) has the molecular formula C20H17ClFN5O2 and a molecular weight of 413.84 g/mol. Its IUPAC name is N-[2-[2-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]hydrazinyl]-2-oxoethyl]-4-fluorobenzamide.
| Compound Name | N-[2-[2-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]hydrazinyl]-2-oxoethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 5023705 |
| Molecular Formula | C20H17ClFN5O2 |
| Molecular Weight | 413.84 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | N-[2-[2-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]hydrazinyl]-2-oxoethyl]-4-fluorobenzamide |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1C=NNC(=O)CNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H17ClFN5O2/c1-13-17(19(21)27(26-13)16-5-3-2-4-6-16)11-24-25-18(28)12-23-20(29)14-7-9-15(22)10-8-14/h2-11H,12H2,1H3,(H,23,29)(H,25,28) |
| InChIKey | URTARTLGBNMCHU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.84 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|