C20H18ClN5O3 — CID 4040988
N-[2-[2-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]hydrazinyl]-2-oxoethyl]-2-hydroxybenzamide (PubChem CID 4040988) has the molecular formula C20H18ClN5O3 and a molecular weight of 411.85 g/mol. Its IUPAC name is N-[2-[2-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]hydrazinyl]-2-oxoethyl]-2-hydroxybenzamide.
| Compound Name | N-[2-[2-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]hydrazinyl]-2-oxoethyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 4040988 |
| Molecular Formula | C20H18ClN5O3 |
| Molecular Weight | 411.85 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | N-[2-[2-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]hydrazinyl]-2-oxoethyl]-2-hydroxybenzamide |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1C=NNC(=O)CNC(=O)c1ccccc1O |
| InChI | InChI=1S/C20H18ClN5O3/c1-13-16(19(21)26(25-13)14-7-3-2-4-8-14)11-23-24-18(28)12-22-20(29)15-9-5-6-10-17(15)27/h2-11,27H,12H2,1H3,(H,22,29)(H,24,28) |
| InChIKey | LPHIPHIGOXGZGT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.85 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|