C20H20ClN5O — CID 5435233
N-[(Z)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-2-(3-methylanilino)acetamide (PubChem CID 5435233) has the molecular formula C20H20ClN5O and a molecular weight of 381.87 g/mol. Its IUPAC name is N-[(Z)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-2-(3-methylanilino)acetamide.
| Compound Name | N-[(Z)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-2-(3-methylanilino)acetamide |
|---|---|
| PubChem CID | 5435233 |
| Molecular Formula | C20H20ClN5O |
| Molecular Weight | 381.87 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | N-[(Z)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-2-(3-methylanilino)acetamide |
| SMILES | Cc1cccc(NCC(=O)N/N=C\c2c(C)nn(-c3ccccc3)c2Cl)c1 |
| InChI | InChI=1S/C20H20ClN5O/c1-14-7-6-8-16(11-14)22-13-19(27)24-23-12-18-15(2)25-26(20(18)21)17-9-4-3-5-10-17/h3-12,22H,13H2,1-2H3,(H,24,27)/b23-12- |
| InChIKey | PYQJJRMQRFXSLH-FMCGGJTJSA-N |
| XLogP | 3.70 |
| TPSA | 71.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.87 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|