C18H14ClN5O3 — CID 9014963
N-[(Z)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-4-nitrobenzamide (PubChem CID 9014963) has the molecular formula C18H14ClN5O3 and a molecular weight of 383.80 g/mol. Its IUPAC name is N-[(Z)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-4-nitrobenzamide.
| Compound Name | N-[(Z)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 9014963 |
| Molecular Formula | C18H14ClN5O3 |
| Molecular Weight | 383.80 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | N-[(Z)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-4-nitrobenzamide |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1/C=N\NC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H14ClN5O3/c1-12-16(17(19)23(22-12)14-5-3-2-4-6-14)11-20-21-18(25)13-7-9-15(10-8-13)24(26)27/h2-11H,1H3,(H,21,25)/b20-11- |
| InChIKey | DKJYDWUUIZPQHS-JAIQZWGSSA-N |
| XLogP | 3.51 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.80 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|