C16H14ClN7O3 — CID 6884361
N-[(E)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-1-methyl-4-nitropyrazole-3-carboxamide (PubChem CID 6884361) has the molecular formula C16H14ClN7O3 and a molecular weight of 387.79 g/mol. Its IUPAC name is N-[(E)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-1-methyl-4-nitropyrazole-3-carboxamide.
| Compound Name | N-[(E)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-1-methyl-4-nitropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 6884361 |
| Molecular Formula | C16H14ClN7O3 |
| Molecular Weight | 387.79 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | N-[(E)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-1-methyl-4-nitropyrazole-3-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1/C=N/NC(=O)c1nn(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14ClN7O3/c1-10-12(15(17)23(20-10)11-6-4-3-5-7-11)8-18-19-16(25)14-13(24(26)27)9-22(2)21-14/h3-9H,1-2H3,(H,19,25)/b18-8+ |
| InChIKey | YNZIGSOKAWOTEO-QGMBQPNBSA-N |
| XLogP | 2.24 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.79 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|