C19H15BrClN5O4 — CID 5442415
2-(2-bromo-4-nitrophenoxy)-N-[(Z)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]acetamide (PubChem CID 5442415) has the molecular formula C19H15BrClN5O4 and a molecular weight of 492.72 g/mol. Its IUPAC name is 2-(2-bromo-4-nitrophenoxy)-N-[(Z)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]acetamide.
| Compound Name | 2-(2-bromo-4-nitrophenoxy)-N-[(Z)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 5442415 |
| Molecular Formula | C19H15BrClN5O4 |
| Molecular Weight | 492.72 g/mol |
| Exact Mass | 491.00 |
| IUPAC Name | 2-(2-bromo-4-nitrophenoxy)-N-[(Z)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]acetamide |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1/C=N\NC(=O)COc1ccc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C19H15BrClN5O4/c1-12-15(19(21)25(24-12)13-5-3-2-4-6-13)10-22-23-18(27)11-30-17-8-7-14(26(28)29)9-16(17)20/h2-10H,11H2,1H3,(H,23,27)/b22-10- |
| InChIKey | LNUOJQBRXCKBPG-YVNNLAQVSA-N |
| XLogP | 4.03 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.72 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|