C23H20N6O4 — CID 119081288
2-(3,6-dimethyl-1-phenylpyrazolo[3,4-b]pyridin-4-yl)oxy-N-[(E)-(4-nitrophenyl)methylideneamino]acetamide (PubChem CID 119081288) has the molecular formula C23H20N6O4 and a molecular weight of 444.45 g/mol. Its IUPAC name is 2-(3,6-dimethyl-1-phenylpyrazolo[3,4-b]pyridin-4-yl)oxy-N-[(E)-(4-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-(3,6-dimethyl-1-phenylpyrazolo[3,4-b]pyridin-4-yl)oxy-N-[(E)-(4-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 119081288 |
| Molecular Formula | C23H20N6O4 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 2-(3,6-dimethyl-1-phenylpyrazolo[3,4-b]pyridin-4-yl)oxy-N-[(E)-(4-nitrophenyl)methylideneamino]acetamide |
| SMILES | Cc1cc(OCC(=O)N/N=C/c2ccc([N+](=O)[O-])cc2)c2c(C)nn(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C23H20N6O4/c1-15-12-20(22-16(2)27-28(23(22)25-15)18-6-4-3-5-7-18)33-14-21(30)26-24-13-17-8-10-19(11-9-17)29(31)32/h3-13H,14H2,1-2H3,(H,26,30)/b24-13+ |
| InChIKey | WTDFEKPJLXZHRM-ZMOGYAJESA-N |
| XLogP | 3.47 |
| TPSA | 124.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|