C19H14BrN3O4 — CID 4633369
2-(1-bromonaphthalen-2-yl)oxy-N-[(4-nitrophenyl)methylideneamino]acetamide (PubChem CID 4633369) has the molecular formula C19H14BrN3O4 and a molecular weight of 428.24 g/mol. Its IUPAC name is 2-(1-bromonaphthalen-2-yl)oxy-N-[(4-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-(1-bromonaphthalen-2-yl)oxy-N-[(4-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 4633369 |
| Molecular Formula | C19H14BrN3O4 |
| Molecular Weight | 428.24 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | 2-(1-bromonaphthalen-2-yl)oxy-N-[(4-nitrophenyl)methylideneamino]acetamide |
| SMILES | O=C(COc1ccc2ccccc2c1Br)NN=Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H14BrN3O4/c20-19-16-4-2-1-3-14(16)7-10-17(19)27-12-18(24)22-21-11-13-5-8-15(9-6-13)23(25)26/h1-11H,12H2,(H,22,24) |
| InChIKey | OACNXKOZGSPHSG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.24 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|