C20H18ClIN4O3 — CID 5440175
N-[(Z)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-2-(2-iodo-4-methoxyphenoxy)acetamide (PubChem CID 5440175) has the molecular formula C20H18ClIN4O3 and a molecular weight of 524.75 g/mol. Its IUPAC name is N-[(Z)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-2-(2-iodo-4-methoxyphenoxy)acetamide.
| Compound Name | N-[(Z)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-2-(2-iodo-4-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 5440175 |
| Molecular Formula | C20H18ClIN4O3 |
| Molecular Weight | 524.75 g/mol |
| Exact Mass | 524.01 |
| IUPAC Name | N-[(Z)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-2-(2-iodo-4-methoxyphenoxy)acetamide |
| SMILES | COc1ccc(OCC(=O)N/N=C\c2c(C)nn(-c3ccccc3)c2Cl)c(I)c1 |
| InChI | InChI=1S/C20H18ClIN4O3/c1-13-16(20(21)26(25-13)14-6-4-3-5-7-14)11-23-24-19(27)12-29-18-9-8-15(28-2)10-17(18)22/h3-11H,12H2,1-2H3,(H,24,27)/b23-11- |
| InChIKey | DQFVFKZEEHSAKP-KSEXSDGBSA-N |
| XLogP | 3.98 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.75 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|