C20H18Cl2N4O3 — CID 18272118
N-[(E)-[5-chloro-1-(2-chlorophenyl)-3-methylpyrazol-4-yl]methylideneamino]-2-(4-methoxyphenoxy)acetamide (PubChem CID 18272118) has the molecular formula C20H18Cl2N4O3 and a molecular weight of 433.30 g/mol. Its IUPAC name is N-[(E)-[5-chloro-1-(2-chlorophenyl)-3-methylpyrazol-4-yl]methylideneamino]-2-(4-methoxyphenoxy)acetamide.
| Compound Name | N-[(E)-[5-chloro-1-(2-chlorophenyl)-3-methylpyrazol-4-yl]methylideneamino]-2-(4-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 18272118 |
| Molecular Formula | C20H18Cl2N4O3 |
| Molecular Weight | 433.30 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | N-[(E)-[5-chloro-1-(2-chlorophenyl)-3-methylpyrazol-4-yl]methylideneamino]-2-(4-methoxyphenoxy)acetamide |
| SMILES | COc1ccc(OCC(=O)N/N=C/c2c(C)nn(-c3ccccc3Cl)c2Cl)cc1 |
| InChI | InChI=1S/C20H18Cl2N4O3/c1-13-16(20(22)26(25-13)18-6-4-3-5-17(18)21)11-23-24-19(27)12-29-15-9-7-14(28-2)8-10-15/h3-11H,12H2,1-2H3,(H,24,27)/b23-11+ |
| InChIKey | MIYCBIXOOXUWED-FOKLQQMPSA-N |
| XLogP | 4.03 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.30 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|