C17H13ClFN5O — CID 8005059
N-[(Z)-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylideneamino]pyridine-2-carboxamide (PubChem CID 8005059) has the molecular formula C17H13ClFN5O and a molecular weight of 357.78 g/mol. Its IUPAC name is N-[(Z)-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylideneamino]pyridine-2-carboxamide.
| Compound Name | N-[(Z)-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylideneamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 8005059 |
| Molecular Formula | C17H13ClFN5O |
| Molecular Weight | 357.78 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | N-[(Z)-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylideneamino]pyridine-2-carboxamide |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(Cl)c1/C=N\NC(=O)c1ccccn1 |
| InChI | InChI=1S/C17H13ClFN5O/c1-11-14(10-21-22-17(25)15-4-2-3-9-20-15)16(18)24(23-11)13-7-5-12(19)6-8-13/h2-10H,1H3,(H,22,25)/b21-10- |
| InChIKey | FESJLFUJFCECKR-FBHDLOMBSA-N |
| XLogP | 3.13 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.78 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|