C24H26ClFN6O — CID 42991252
N-[(E)-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylideneamino]-3-(4-phenylpiperazin-1-yl)propanamide (PubChem CID 42991252) has the molecular formula C24H26ClFN6O and a molecular weight of 468.96 g/mol. Its IUPAC name is N-[(E)-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylideneamino]-3-(4-phenylpiperazin-1-yl)propanamide.
| Compound Name | N-[(E)-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylideneamino]-3-(4-phenylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 42991252 |
| Molecular Formula | C24H26ClFN6O |
| Molecular Weight | 468.96 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | N-[(E)-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]methylideneamino]-3-(4-phenylpiperazin-1-yl)propanamide |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(Cl)c1/C=N/NC(=O)CCN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H26ClFN6O/c1-18-22(24(25)32(29-18)21-9-7-19(26)8-10-21)17-27-28-23(33)11-12-30-13-15-31(16-14-30)20-5-3-2-4-6-20/h2-10,17H,11-16H2,1H3,(H,28,33)/b27-17+ |
| InChIKey | LPHKEMPTFRSWTE-WPWMEQJKSA-N |
| XLogP | 3.64 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.96 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|