C28H27ClN4O — CID 16555946
N-[(E)-(10-chloroanthracen-9-yl)methylideneamino]-3-(4-phenylpiperazin-1-yl)propanamide (PubChem CID 16555946) has the molecular formula C28H27ClN4O and a molecular weight of 471.00 g/mol. Its IUPAC name is N-[(E)-(10-chloroanthracen-9-yl)methylideneamino]-3-(4-phenylpiperazin-1-yl)propanamide.
| Compound Name | N-[(E)-(10-chloroanthracen-9-yl)methylideneamino]-3-(4-phenylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 16555946 |
| Molecular Formula | C28H27ClN4O |
| Molecular Weight | 471.00 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | N-[(E)-(10-chloroanthracen-9-yl)methylideneamino]-3-(4-phenylpiperazin-1-yl)propanamide |
| SMILES | O=C(CCN1CCN(c2ccccc2)CC1)N/N=C/c1c2ccccc2c(Cl)c2ccccc12 |
| InChI | InChI=1S/C28H27ClN4O/c29-28-24-12-6-4-10-22(24)26(23-11-5-7-13-25(23)28)20-30-31-27(34)14-15-32-16-18-33(19-17-32)21-8-2-1-3-9-21/h1-13,20H,14-19H2,(H,31,34)/b30-20+ |
| InChIKey | OWPSQSAAIXTHLW-TWKHWXDSSA-N |
| XLogP | 5.31 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.00 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|