C20H23ClN4O — CID 2477195
N-[(3-chlorophenyl)methylideneamino]-3-(4-phenylpiperazin-1-yl)propanamide (PubChem CID 2477195) has the molecular formula C20H23ClN4O and a molecular weight of 370.88 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methylideneamino]-3-(4-phenylpiperazin-1-yl)propanamide.
| Compound Name | N-[(3-chlorophenyl)methylideneamino]-3-(4-phenylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 2477195 |
| Molecular Formula | C20H23ClN4O |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | N-[(3-chlorophenyl)methylideneamino]-3-(4-phenylpiperazin-1-yl)propanamide |
| SMILES | O=C(CCN1CCN(c2ccccc2)CC1)NN=Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H23ClN4O/c21-18-6-4-5-17(15-18)16-22-23-20(26)9-10-24-11-13-25(14-12-24)19-7-2-1-3-8-19/h1-8,15-16H,9-14H2,(H,23,26) |
| InChIKey | PDVIVGGWEKVPBX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|