C22H25ClN4O2 — CID 18272424
4-chloro-N-[3-[(E)-(3-piperidin-1-ylpropanoylhydrazinylidene)methyl]phenyl]benzamide (PubChem CID 18272424) has the molecular formula C22H25ClN4O2 and a molecular weight of 412.92 g/mol. Its IUPAC name is 4-chloro-N-[3-[(E)-(3-piperidin-1-ylpropanoylhydrazinylidene)methyl]phenyl]benzamide.
| Compound Name | 4-chloro-N-[3-[(E)-(3-piperidin-1-ylpropanoylhydrazinylidene)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 18272424 |
| Molecular Formula | C22H25ClN4O2 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 4-chloro-N-[3-[(E)-(3-piperidin-1-ylpropanoylhydrazinylidene)methyl]phenyl]benzamide |
| SMILES | O=C(CCN1CCCCC1)N/N=C/c1cccc(NC(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C22H25ClN4O2/c23-19-9-7-18(8-10-19)22(29)25-20-6-4-5-17(15-20)16-24-26-21(28)11-14-27-12-2-1-3-13-27/h4-10,15-16H,1-3,11-14H2,(H,25,29)(H,26,28)/b24-16+ |
| InChIKey | FUUQOTHIAMLLKA-LFVJCYFKSA-N |
| XLogP | 3.92 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|