C15H20BrN3O — CID 5346912
N-[(E)-(4-bromophenyl)methylideneamino]-3-piperidin-1-ylpropanamide (PubChem CID 5346912) has the molecular formula C15H20BrN3O and a molecular weight of 338.25 g/mol. Its IUPAC name is N-[(E)-(4-bromophenyl)methylideneamino]-3-piperidin-1-ylpropanamide.
| Compound Name | N-[(E)-(4-bromophenyl)methylideneamino]-3-piperidin-1-ylpropanamide |
|---|---|
| PubChem CID | 5346912 |
| Molecular Formula | C15H20BrN3O |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | N-[(E)-(4-bromophenyl)methylideneamino]-3-piperidin-1-ylpropanamide |
| SMILES | O=C(CCN1CCCCC1)N/N=C/c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H20BrN3O/c16-14-6-4-13(5-7-14)12-17-18-15(20)8-11-19-9-2-1-3-10-19/h4-7,12H,1-3,8-11H2,(H,18,20)/b17-12+ |
| InChIKey | GQUOJRXBJJSJJI-SFQUDFHCSA-N |
| XLogP | 2.78 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|