C14H17BrN2O3 — CID 23749398
7-[(2E)-2-[(4-bromophenyl)methylidene]hydrazinyl]-7-oxoheptanoic acid (PubChem CID 23749398) has the molecular formula C14H17BrN2O3 and a molecular weight of 341.20 g/mol. Its IUPAC name is 7-[(2E)-2-[(4-bromophenyl)methylidene]hydrazinyl]-7-oxoheptanoic acid.
| Compound Name | 7-[(2E)-2-[(4-bromophenyl)methylidene]hydrazinyl]-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 23749398 |
| Molecular Formula | C14H17BrN2O3 |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 7-[(2E)-2-[(4-bromophenyl)methylidene]hydrazinyl]-7-oxoheptanoic acid |
| SMILES | O=C(O)CCCCCC(=O)N/N=C/c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H17BrN2O3/c15-12-8-6-11(7-9-12)10-16-17-13(18)4-2-1-3-5-14(19)20/h6-10H,1-5H2,(H,17,18)(H,19,20)/b16-10+ |
| InChIKey | QVWDNCZNJZSTNP-MHWRWJLKSA-N |
| XLogP | 2.93 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|