C15H21N3O4 — CID 135883129
N'-hydroxy-N-[(E)-(4-hydroxyphenyl)methylideneamino]octanediamide (PubChem CID 135883129) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is N'-hydroxy-N-[(E)-(4-hydroxyphenyl)methylideneamino]octanediamide.
| Compound Name | N'-hydroxy-N-[(E)-(4-hydroxyphenyl)methylideneamino]octanediamide |
|---|---|
| PubChem CID | 135883129 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | N'-hydroxy-N-[(E)-(4-hydroxyphenyl)methylideneamino]octanediamide |
| SMILES | O=C(CCCCCCC(=O)N/N=C/c1ccc(O)cc1)NO |
| InChI | InChI=1S/C15H21N3O4/c19-13-9-7-12(8-10-13)11-16-17-14(20)5-3-1-2-4-6-15(21)18-22/h7-11,19,22H,1-6H2,(H,17,20)(H,18,21)/b16-11+ |
| InChIKey | MEHBBSQFHOQSGW-LFIBNONCSA-N |
| XLogP | 1.69 |
| TPSA | 111.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|