C18H18N4O4 — CID 136704221
N,N'-bis[(Z)-(4-hydroxyphenyl)methylideneamino]butanediamide (PubChem CID 136704221) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is N,N'-bis[(Z)-(4-hydroxyphenyl)methylideneamino]butanediamide.
| Compound Name | N,N'-bis[(Z)-(4-hydroxyphenyl)methylideneamino]butanediamide |
|---|---|
| PubChem CID | 136704221 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | N,N'-bis[(Z)-(4-hydroxyphenyl)methylideneamino]butanediamide |
| SMILES | O=C(CCC(=O)N/N=C\c1ccc(O)cc1)N/N=C\c1ccc(O)cc1 |
| InChI | InChI=1S/C18H18N4O4/c23-15-5-1-13(2-6-15)11-19-21-17(25)9-10-18(26)22-20-12-14-3-7-16(24)8-4-14/h1-8,11-12,23-24H,9-10H2,(H,21,25)(H,22,26)/b19-11-,20-12- |
| InChIKey | AHDLADZFJAFOBI-YZLQMOBTSA-N |
| XLogP | 1.48 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|