C24H28F2N4O2 — CID 6277081
N,N'-bis[(Z)-(4-fluorophenyl)methylideneamino]decanediamide (PubChem CID 6277081) has the molecular formula C24H28F2N4O2 and a molecular weight of 442.51 g/mol. Its IUPAC name is N,N'-bis[(Z)-(4-fluorophenyl)methylideneamino]decanediamide.
| Compound Name | N,N'-bis[(Z)-(4-fluorophenyl)methylideneamino]decanediamide |
|---|---|
| PubChem CID | 6277081 |
| Molecular Formula | C24H28F2N4O2 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | N,N'-bis[(Z)-(4-fluorophenyl)methylideneamino]decanediamide |
| SMILES | O=C(CCCCCCCCC(=O)N/N=C\c1ccc(F)cc1)N/N=C\c1ccc(F)cc1 |
| InChI | InChI=1S/C24H28F2N4O2/c25-21-13-9-19(10-14-21)17-27-29-23(31)7-5-3-1-2-4-6-8-24(32)30-28-18-20-11-15-22(26)16-12-20/h9-18H,1-8H2,(H,29,31)(H,30,32)/b27-17-,28-18- |
| InChIKey | MBAYKYNITYAXIA-HJTNQMAYSA-N |
| XLogP | 4.69 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|