C19H18I2N4O2 — CID 54610044
N-[(E)-(4-iodophenyl)methylideneamino]-N'-[(Z)-(4-iodophenyl)methylideneamino]pentanediamide (PubChem CID 54610044) has the molecular formula C19H18I2N4O2 and a molecular weight of 588.19 g/mol. Its IUPAC name is N-[(E)-(4-iodophenyl)methylideneamino]-N'-[(Z)-(4-iodophenyl)methylideneamino]pentanediamide.
| Compound Name | N-[(E)-(4-iodophenyl)methylideneamino]-N'-[(Z)-(4-iodophenyl)methylideneamino]pentanediamide |
|---|---|
| PubChem CID | 54610044 |
| Molecular Formula | C19H18I2N4O2 |
| Molecular Weight | 588.19 g/mol |
| Exact Mass | 587.95 |
| IUPAC Name | N-[(E)-(4-iodophenyl)methylideneamino]-N'-[(Z)-(4-iodophenyl)methylideneamino]pentanediamide |
| SMILES | O=C(CCCC(=O)N/N=C/c1ccc(I)cc1)N/N=C\c1ccc(I)cc1 |
| InChI | InChI=1S/C19H18I2N4O2/c20-16-8-4-14(5-9-16)12-22-24-18(26)2-1-3-19(27)25-23-13-15-6-10-17(21)11-7-15/h4-13H,1-3H2,(H,24,26)(H,25,27)/b22-12-,23-13+ |
| InChIKey | UDURPWRPCSXESZ-SEKXJNOLSA-N |
| XLogP | 3.67 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.19 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|