C35H32FN3O3 — CID 2370159
N-[[3-(4-fluorobenzoyl)-2-methylindolizin-1-yl]methylideneamino]-4-[(5-methyl-2-propan-2-ylphenoxy)methyl]benzamide (PubChem CID 2370159) has the molecular formula C35H32FN3O3 and a molecular weight of 561.66 g/mol. Its IUPAC name is N-[[3-(4-fluorobenzoyl)-2-methylindolizin-1-yl]methylideneamino]-4-[(5-methyl-2-propan-2-ylphenoxy)methyl]benzamide.
| Compound Name | N-[[3-(4-fluorobenzoyl)-2-methylindolizin-1-yl]methylideneamino]-4-[(5-methyl-2-propan-2-ylphenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 2370159 |
| Molecular Formula | C35H32FN3O3 |
| Molecular Weight | 561.66 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | N-[[3-(4-fluorobenzoyl)-2-methylindolizin-1-yl]methylideneamino]-4-[(5-methyl-2-propan-2-ylphenoxy)methyl]benzamide |
| SMILES | Cc1ccc(C(C)C)c(OCc2ccc(C(=O)NN=Cc3c(C)c(C(=O)c4ccc(F)cc4)n4ccccc34)cc2)c1 |
| InChI | InChI=1S/C35H32FN3O3/c1-22(2)29-17-8-23(3)19-32(29)42-21-25-9-11-27(12-10-25)35(41)38-37-20-30-24(4)33(39-18-6-5-7-31(30)39)34(40)26-13-15-28(36)16-14-26/h5-20,22H,21H2,1-4H3,(H,38,41) |
| InChIKey | XFYKCTKBNZGLCO-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.66 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|