C25H24Br2N2O3 — CID 135576961
N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-4-[(5-methyl-2-propan-2-ylphenoxy)methyl]benzamide (PubChem CID 135576961) has the molecular formula C25H24Br2N2O3 and a molecular weight of 560.29 g/mol. Its IUPAC name is N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-4-[(5-methyl-2-propan-2-ylphenoxy)methyl]benzamide.
| Compound Name | N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-4-[(5-methyl-2-propan-2-ylphenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 135576961 |
| Molecular Formula | C25H24Br2N2O3 |
| Molecular Weight | 560.29 g/mol |
| Exact Mass | 558.02 |
| IUPAC Name | N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-4-[(5-methyl-2-propan-2-ylphenoxy)methyl]benzamide |
| SMILES | Cc1ccc(C(C)C)c(OCc2ccc(C(=O)N/N=C/c3cc(Br)cc(Br)c3O)cc2)c1 |
| InChI | InChI=1S/C25H24Br2N2O3/c1-15(2)21-9-4-16(3)10-23(21)32-14-17-5-7-18(8-6-17)25(31)29-28-13-19-11-20(26)12-22(27)24(19)30/h4-13,15,30H,14H2,1-3H3,(H,29,31)/b28-13+ |
| InChIKey | XRHLMXUHJPPEEB-XODNFHPESA-N |
| XLogP | 6.69 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.29 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|