C28H32N2O5 — CID 2368223
4-[(5-methyl-2-propan-2-ylphenoxy)methyl]-N-[(2,4,5-trimethoxyphenyl)methylideneamino]benzamide (PubChem CID 2368223) has the molecular formula C28H32N2O5 and a molecular weight of 476.57 g/mol. Its IUPAC name is 4-[(5-methyl-2-propan-2-ylphenoxy)methyl]-N-[(2,4,5-trimethoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-[(5-methyl-2-propan-2-ylphenoxy)methyl]-N-[(2,4,5-trimethoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 2368223 |
| Molecular Formula | C28H32N2O5 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 4-[(5-methyl-2-propan-2-ylphenoxy)methyl]-N-[(2,4,5-trimethoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1cc(OC)c(OC)cc1C=NNC(=O)c1ccc(COc2cc(C)ccc2C(C)C)cc1 |
| InChI | InChI=1S/C28H32N2O5/c1-18(2)23-12-7-19(3)13-25(23)35-17-20-8-10-21(11-9-20)28(31)30-29-16-22-14-26(33-5)27(34-6)15-24(22)32-4/h7-16,18H,17H2,1-6H3,(H,30,31) |
| InChIKey | JMRSQAJYYJUIRM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|