C30H36N2O2 — CID 6112531
N-[(Z)-1-(4-tert-butylphenyl)ethylideneamino]-4-[(5-methyl-2-propan-2-ylphenoxy)methyl]benzamide (PubChem CID 6112531) has the molecular formula C30H36N2O2 and a molecular weight of 456.63 g/mol. Its IUPAC name is N-[(Z)-1-(4-tert-butylphenyl)ethylideneamino]-4-[(5-methyl-2-propan-2-ylphenoxy)methyl]benzamide.
| Compound Name | N-[(Z)-1-(4-tert-butylphenyl)ethylideneamino]-4-[(5-methyl-2-propan-2-ylphenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 6112531 |
| Molecular Formula | C30H36N2O2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | N-[(Z)-1-(4-tert-butylphenyl)ethylideneamino]-4-[(5-methyl-2-propan-2-ylphenoxy)methyl]benzamide |
| SMILES | C/C(=N/NC(=O)c1ccc(COc2cc(C)ccc2C(C)C)cc1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H36N2O2/c1-20(2)27-17-8-21(3)18-28(27)34-19-23-9-11-25(12-10-23)29(33)32-31-22(4)24-13-15-26(16-14-24)30(5,6)7/h8-18,20H,19H2,1-7H3,(H,32,33)/b31-22- |
| InChIKey | CSFKHWHNJYFZNR-VAMRJTSQSA-N |
| XLogP | 7.15 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|