C26H16FN3OS — CID 6165665
(E)-2-(1,3-benzothiazol-2-yl)-3-[3-(4-fluorobenzoyl)-2-methylindolizin-1-yl]prop-2-enenitrile (PubChem CID 6165665) has the molecular formula C26H16FN3OS and a molecular weight of 437.50 g/mol. Its IUPAC name is (E)-2-(1,3-benzothiazol-2-yl)-3-[3-(4-fluorobenzoyl)-2-methylindolizin-1-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(1,3-benzothiazol-2-yl)-3-[3-(4-fluorobenzoyl)-2-methylindolizin-1-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 6165665 |
| Molecular Formula | C26H16FN3OS |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | (E)-2-(1,3-benzothiazol-2-yl)-3-[3-(4-fluorobenzoyl)-2-methylindolizin-1-yl]prop-2-enenitrile |
| SMILES | Cc1c(/C=C(\C#N)c2nc3ccccc3s2)c2ccccn2c1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H16FN3OS/c1-16-20(14-18(15-28)26-29-21-6-2-3-8-23(21)32-26)22-7-4-5-13-30(22)24(16)25(31)17-9-11-19(27)12-10-17/h2-14H,1H3/b18-14+ |
| InChIKey | IPCFKHCLNYFOEO-NBVRZTHBSA-N |
| XLogP | 6.29 |
| TPSA | 58.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|