C27H18ClF2N3O2S — CID 4249350
3-[3-(4-chlorobenzoyl)-2-methylindolizin-1-yl]-2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]prop-2-enamide (PubChem CID 4249350) has the molecular formula C27H18ClF2N3O2S and a molecular weight of 521.98 g/mol. Its IUPAC name is 3-[3-(4-chlorobenzoyl)-2-methylindolizin-1-yl]-2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]prop-2-enamide.
| Compound Name | 3-[3-(4-chlorobenzoyl)-2-methylindolizin-1-yl]-2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 4249350 |
| Molecular Formula | C27H18ClF2N3O2S |
| Molecular Weight | 521.98 g/mol |
| Exact Mass | 521.08 |
| IUPAC Name | 3-[3-(4-chlorobenzoyl)-2-methylindolizin-1-yl]-2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]prop-2-enamide |
| SMILES | Cc1c(C=C(C#N)C(=O)Nc2ccc(SC(F)F)cc2)c2ccccn2c1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H18ClF2N3O2S/c1-16-22(14-18(15-31)26(35)32-20-9-11-21(12-10-20)36-27(29)30)23-4-2-3-13-33(23)24(16)25(34)17-5-7-19(28)8-6-17/h2-14,27H,1H3,(H,32,35) |
| InChIKey | VRWQUMUBNAUYSL-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 74.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.98 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|