C19H16F2N2OS — CID 6038822
(E)-2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]-3-(2,5-dimethylphenyl)prop-2-enamide (PubChem CID 6038822) has the molecular formula C19H16F2N2OS and a molecular weight of 358.41 g/mol. Its IUPAC name is (E)-2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]-3-(2,5-dimethylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]-3-(2,5-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6038822 |
| Molecular Formula | C19H16F2N2OS |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | (E)-2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]-3-(2,5-dimethylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(C)c(/C=C(\C#N)C(=O)Nc2ccc(SC(F)F)cc2)c1 |
| InChI | InChI=1S/C19H16F2N2OS/c1-12-3-4-13(2)14(9-12)10-15(11-22)18(24)23-16-5-7-17(8-6-16)25-19(20)21/h3-10,19H,1-2H3,(H,23,24)/b15-10+ |
| InChIKey | XPNODTQONREGDF-XNTDXEJSSA-N |
| XLogP | 5.16 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|