C20H18F2N2O3S — CID 8014554
(E)-2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]-3-(3-ethoxy-4-methoxyphenyl)prop-2-enamide (PubChem CID 8014554) has the molecular formula C20H18F2N2O3S and a molecular weight of 404.44 g/mol. Its IUPAC name is (E)-2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]-3-(3-ethoxy-4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]-3-(3-ethoxy-4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 8014554 |
| Molecular Formula | C20H18F2N2O3S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | (E)-2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]-3-(3-ethoxy-4-methoxyphenyl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C(\C#N)C(=O)Nc2ccc(SC(F)F)cc2)ccc1OC |
| InChI | InChI=1S/C20H18F2N2O3S/c1-3-27-18-11-13(4-9-17(18)26-2)10-14(12-23)19(25)24-15-5-7-16(8-6-15)28-20(21)22/h4-11,20H,3H2,1-2H3,(H,24,25)/b14-10+ |
| InChIKey | XJUJRGJKAVIJEN-GXDHUFHOSA-N |
| XLogP | 4.95 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|