C22H16F2N2O2S — CID 18226576
(E)-2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]-3-(6-methoxynaphthalen-2-yl)prop-2-enamide (PubChem CID 18226576) has the molecular formula C22H16F2N2O2S and a molecular weight of 410.45 g/mol. Its IUPAC name is (E)-2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]-3-(6-methoxynaphthalen-2-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]-3-(6-methoxynaphthalen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 18226576 |
| Molecular Formula | C22H16F2N2O2S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | (E)-2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]-3-(6-methoxynaphthalen-2-yl)prop-2-enamide |
| SMILES | COc1ccc2cc(/C=C(\C#N)C(=O)Nc3ccc(SC(F)F)cc3)ccc2c1 |
| InChI | InChI=1S/C22H16F2N2O2S/c1-28-19-7-4-15-10-14(2-3-16(15)12-19)11-17(13-25)21(27)26-18-5-8-20(9-6-18)29-22(23)24/h2-12,22H,1H3,(H,26,27)/b17-11+ |
| InChIKey | VIYVZBHPBCZVTQ-GZTJUZNOSA-N |
| XLogP | 5.71 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|