C17H11F2N3O3S — CID 2439628
(Z)-2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 2439628) has the molecular formula C17H11F2N3O3S and a molecular weight of 375.36 g/mol. Its IUPAC name is (Z)-2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2439628 |
| Molecular Formula | C17H11F2N3O3S |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | (Z)-2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | N#C/C(=C/c1ccc([N+](=O)[O-])cc1)C(=O)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C17H11F2N3O3S/c18-17(19)26-15-7-3-13(4-8-15)21-16(23)12(10-20)9-11-1-5-14(6-2-11)22(24)25/h1-9,17H,(H,21,23)/b12-9- |
| InChIKey | BFVCQJNWWIGDJF-XFXZXTDPSA-N |
| XLogP | 4.46 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|