C23H20N2O4 — CID 6214668
(E)-2-cyano-N-(3,4-dimethoxyphenyl)-3-(6-methoxynaphthalen-2-yl)prop-2-enamide (PubChem CID 6214668) has the molecular formula C23H20N2O4 and a molecular weight of 388.42 g/mol. Its IUPAC name is (E)-2-cyano-N-(3,4-dimethoxyphenyl)-3-(6-methoxynaphthalen-2-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(3,4-dimethoxyphenyl)-3-(6-methoxynaphthalen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 6214668 |
| Molecular Formula | C23H20N2O4 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | (E)-2-cyano-N-(3,4-dimethoxyphenyl)-3-(6-methoxynaphthalen-2-yl)prop-2-enamide |
| SMILES | COc1ccc2cc(/C=C(\C#N)C(=O)Nc3ccc(OC)c(OC)c3)ccc2c1 |
| InChI | InChI=1S/C23H20N2O4/c1-27-20-8-6-16-10-15(4-5-17(16)12-20)11-18(14-24)23(26)25-19-7-9-21(28-2)22(13-19)29-3/h4-13H,1-3H3,(H,25,26)/b18-11+ |
| InChIKey | XJSMTJNJHUJEMO-WOJGMQOQSA-N |
| XLogP | 4.41 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|