C23H25N3O6 — CID 55351800
(E)-2-cyano-N-(3,4-dimethoxyphenyl)-3-[4-[2-(ethylamino)-2-oxoethoxy]-3-methoxyphenyl]prop-2-enamide (PubChem CID 55351800) has the molecular formula C23H25N3O6 and a molecular weight of 439.47 g/mol. Its IUPAC name is (E)-2-cyano-N-(3,4-dimethoxyphenyl)-3-[4-[2-(ethylamino)-2-oxoethoxy]-3-methoxyphenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(3,4-dimethoxyphenyl)-3-[4-[2-(ethylamino)-2-oxoethoxy]-3-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55351800 |
| Molecular Formula | C23H25N3O6 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | (E)-2-cyano-N-(3,4-dimethoxyphenyl)-3-[4-[2-(ethylamino)-2-oxoethoxy]-3-methoxyphenyl]prop-2-enamide |
| SMILES | CCNC(=O)COc1ccc(/C=C(\C#N)C(=O)Nc2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C23H25N3O6/c1-5-25-22(27)14-32-19-8-6-15(11-20(19)30-3)10-16(13-24)23(28)26-17-7-9-18(29-2)21(12-17)31-4/h6-12H,5,14H2,1-4H3,(H,25,27)(H,26,28)/b16-10+ |
| InChIKey | XKVNAZJNRSVWAS-MHWRWJLKSA-N |
| XLogP | 2.77 |
| TPSA | 118.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|