C20H18F2N2O5 — CID 2445116
(Z)-2-cyano-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-(3,4-dimethoxyphenyl)prop-2-enamide (PubChem CID 2445116) has the molecular formula C20H18F2N2O5 and a molecular weight of 404.37 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-(3,4-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-(3,4-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2445116 |
| Molecular Formula | C20H18F2N2O5 |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | (Z)-2-cyano-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-(3,4-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C(C#N)=C\c2ccc(OC(F)F)c(OC)c2)cc1OC |
| InChI | InChI=1S/C20H18F2N2O5/c1-26-15-7-5-14(10-18(15)28-3)24-19(25)13(11-23)8-12-4-6-16(29-20(21)22)17(9-12)27-2/h4-10,20H,1-3H3,(H,24,25)/b13-8- |
| InChIKey | VAKKTMAKDXDUEC-JYRVWZFOSA-N |
| XLogP | 3.86 |
| TPSA | 89.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|