C15H11F2N3O3S — CID 2623313
(E)-2-cyano-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 2623313) has the molecular formula C15H11F2N3O3S and a molecular weight of 351.33 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 2623313 |
| Molecular Formula | C15H11F2N3O3S |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | (E)-2-cyano-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | COc1cc(/C=C(\C#N)C(=O)Nc2nccs2)ccc1OC(F)F |
| InChI | InChI=1S/C15H11F2N3O3S/c1-22-12-7-9(2-3-11(12)23-14(16)17)6-10(8-18)13(21)20-15-19-4-5-24-15/h2-7,14H,1H3,(H,19,20,21)/b10-6+ |
| InChIKey | IHPYPZHREKVVCP-UXBLZVDNSA-N |
| XLogP | 3.30 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|