C19H16F2N2O3S — CID 7966852
(E)-2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]-3-(2,3-dimethoxyphenyl)prop-2-enamide (PubChem CID 7966852) has the molecular formula C19H16F2N2O3S and a molecular weight of 390.41 g/mol. Its IUPAC name is (E)-2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]-3-(2,3-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]-3-(2,3-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 7966852 |
| Molecular Formula | C19H16F2N2O3S |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | (E)-2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]-3-(2,3-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cccc(/C=C(\C#N)C(=O)Nc2ccc(SC(F)F)cc2)c1OC |
| InChI | InChI=1S/C19H16F2N2O3S/c1-25-16-5-3-4-12(17(16)26-2)10-13(11-22)18(24)23-14-6-8-15(9-7-14)27-19(20)21/h3-10,19H,1-2H3,(H,23,24)/b13-10+ |
| InChIKey | QCALLTFQCGFKHJ-JLHYYAGUSA-N |
| XLogP | 4.56 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|