C20H18N2O5 — CID 126245384
(2S)-2-[2-[(Z)-3-anilino-2-cyano-3-oxoprop-1-enyl]-6-methoxyphenoxy]propanoic acid (PubChem CID 126245384) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is (2S)-2-[2-[(Z)-3-anilino-2-cyano-3-oxoprop-1-enyl]-6-methoxyphenoxy]propanoic acid.
| Compound Name | (2S)-2-[2-[(Z)-3-anilino-2-cyano-3-oxoprop-1-enyl]-6-methoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 126245384 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (2S)-2-[2-[(Z)-3-anilino-2-cyano-3-oxoprop-1-enyl]-6-methoxyphenoxy]propanoic acid |
| SMILES | COc1cccc(/C=C(/C#N)C(=O)Nc2ccccc2)c1O[C@@H](C)C(=O)O |
| InChI | InChI=1S/C20H18N2O5/c1-13(20(24)25)27-18-14(7-6-10-17(18)26-2)11-15(12-21)19(23)22-16-8-4-3-5-9-16/h3-11,13H,1-2H3,(H,22,23)(H,24,25)/b15-11-/t13-/m0/s1 |
| InChIKey | OUKZOWVOBYVLFQ-WZMONFQBSA-N |
| XLogP | 3.09 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|