C22H22N2O6 — CID 126235809
(2S)-2-[2-[(Z)-2-cyano-3-(3-ethoxyanilino)-3-oxoprop-1-enyl]-6-methoxyphenoxy]propanoic acid (PubChem CID 126235809) has the molecular formula C22H22N2O6 and a molecular weight of 410.43 g/mol. Its IUPAC name is (2S)-2-[2-[(Z)-2-cyano-3-(3-ethoxyanilino)-3-oxoprop-1-enyl]-6-methoxyphenoxy]propanoic acid.
| Compound Name | (2S)-2-[2-[(Z)-2-cyano-3-(3-ethoxyanilino)-3-oxoprop-1-enyl]-6-methoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 126235809 |
| Molecular Formula | C22H22N2O6 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | (2S)-2-[2-[(Z)-2-cyano-3-(3-ethoxyanilino)-3-oxoprop-1-enyl]-6-methoxyphenoxy]propanoic acid |
| SMILES | CCOc1cccc(NC(=O)/C(C#N)=C\c2cccc(OC)c2O[C@@H](C)C(=O)O)c1 |
| InChI | InChI=1S/C22H22N2O6/c1-4-29-18-9-6-8-17(12-18)24-21(25)16(13-23)11-15-7-5-10-19(28-3)20(15)30-14(2)22(26)27/h5-12,14H,4H2,1-3H3,(H,24,25)(H,26,27)/b16-11-/t14-/m0/s1 |
| InChIKey | RXGPUOVQINXLKE-HNDQUVLASA-N |
| XLogP | 3.49 |
| TPSA | 117.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|