C20H20N2O5 — CID 2208562
(Z)-2-cyano-N-(3-ethoxyphenyl)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enamide (PubChem CID 2208562) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is (Z)-2-cyano-N-(3-ethoxyphenyl)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(3-ethoxyphenyl)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2208562 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | (Z)-2-cyano-N-(3-ethoxyphenyl)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1cccc(NC(=O)/C(C#N)=C\c2cc(OC)c(O)c(OC)c2)c1 |
| InChI | InChI=1S/C20H20N2O5/c1-4-27-16-7-5-6-15(11-16)22-20(24)14(12-21)8-13-9-17(25-2)19(23)18(10-13)26-3/h5-11,23H,4H2,1-3H3,(H,22,24)/b14-8- |
| InChIKey | PGEYBTBIYMZNPY-ZSOIEALJSA-N |
| XLogP | 3.35 |
| TPSA | 100.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|