C19H15N2O4- — CID 2208157
4-[(Z)-2-cyano-3-(3-ethoxyanilino)-3-oxoprop-1-enyl]benzoate (PubChem CID 2208157) has the molecular formula C19H15N2O4- and a molecular weight of 335.34 g/mol. Its IUPAC name is 4-[(Z)-2-cyano-3-(3-ethoxyanilino)-3-oxoprop-1-enyl]benzoate.
| Compound Name | 4-[(Z)-2-cyano-3-(3-ethoxyanilino)-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 2208157 |
| Molecular Formula | C19H15N2O4- |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 4-[(Z)-2-cyano-3-(3-ethoxyanilino)-3-oxoprop-1-enyl]benzoate |
| SMILES | CCOc1cccc(NC(=O)/C(C#N)=C\c2ccc(C(=O)[O-])cc2)c1 |
| InChI | InChI=1S/C19H16N2O4/c1-2-25-17-5-3-4-16(11-17)21-18(22)15(12-20)10-13-6-8-14(9-7-13)19(23)24/h3-11H,2H2,1H3,(H,21,22)(H,23,24)/p-1/b15-10- |
| InChIKey | FNMKCUMKRDGCDN-GDNBJRDFSA-M |
| XLogP | 1.99 |
| TPSA | 102.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|